C8H11F3N2O3S2 — CID 106433688
5-(hydroxymethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]-1H-pyrrole-3-sulfonamide (PubChem CID 106433688) has the molecular formula C8H11F3N2O3S2 and a molecular weight of 304.32 g/mol. Its IUPAC name is 5-(hydroxymethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]-1H-pyrrole-3-sulfonamide.
| Compound Name | 5-(hydroxymethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106433688 |
| Molecular Formula | C8H11F3N2O3S2 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 5-(hydroxymethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]-1H-pyrrole-3-sulfonamide |
| SMILES | O=S(=O)(NCCSC(F)(F)F)c1c[nH]c(CO)c1 |
| InChI | InChI=1S/C8H11F3N2O3S2/c9-8(10,11)17-2-1-13-18(15,16)7-3-6(5-14)12-4-7/h3-4,12-14H,1-2,5H2 |
| InChIKey | JNAPMEOAXRAUAR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|