C7H10F3N3O3S2 — CID 114188372
4-(hydroxymethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]-1H-pyrazole-5-sulfonamide (PubChem CID 114188372) has the molecular formula C7H10F3N3O3S2 and a molecular weight of 305.30 g/mol. Its IUPAC name is 4-(hydroxymethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]-1H-pyrazole-5-sulfonamide.
| Compound Name | 4-(hydroxymethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 114188372 |
| Molecular Formula | C7H10F3N3O3S2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 4-(hydroxymethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]-1H-pyrazole-5-sulfonamide |
| SMILES | O=S(=O)(NCCSC(F)(F)F)c1[nH]ncc1CO |
| InChI | InChI=1S/C7H10F3N3O3S2/c8-7(9,10)17-2-1-12-18(15,16)6-5(4-14)3-11-13-6/h3,12,14H,1-2,4H2,(H,11,13) |
| InChIKey | NUTRRVCAAHBDLZ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|