C11H13F4NO2S2 — CID 106150602
4-fluoro-2,6-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide (PubChem CID 106150602) has the molecular formula C11H13F4NO2S2 and a molecular weight of 331.36 g/mol. Its IUPAC name is 4-fluoro-2,6-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide.
| Compound Name | 4-fluoro-2,6-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106150602 |
| Molecular Formula | C11H13F4NO2S2 |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 4-fluoro-2,6-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)NCCSC(F)(F)F |
| InChI | InChI=1S/C11H13F4NO2S2/c1-7-5-9(12)6-8(2)10(7)20(17,18)16-3-4-19-11(13,14)15/h5-6,16H,3-4H2,1-2H3 |
| InChIKey | SPOWQDUCFYBCPH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|