C11H14BrF3N2O2S2 — CID 106433714
5-(aminomethyl)-2-bromo-3-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide (PubChem CID 106433714) has the molecular formula C11H14BrF3N2O2S2 and a molecular weight of 407.28 g/mol. Its IUPAC name is 5-(aminomethyl)-2-bromo-3-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide.
| Compound Name | 5-(aminomethyl)-2-bromo-3-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106433714 |
| Molecular Formula | C11H14BrF3N2O2S2 |
| Molecular Weight | 407.28 g/mol |
| Exact Mass | 405.96 |
| IUPAC Name | 5-(aminomethyl)-2-bromo-3-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide |
| SMILES | Cc1cc(CN)cc(S(=O)(=O)NCCSC(F)(F)F)c1Br |
| InChI | InChI=1S/C11H14BrF3N2O2S2/c1-7-4-8(6-16)5-9(10(7)12)21(18,19)17-2-3-20-11(13,14)15/h4-5,17H,2-3,6,16H2,1H3 |
| InChIKey | ZVAMSQJZAVVLJJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|