C13H22N2O4S — CID 102701683
5-[(cyclopropylamino)methyl]-N-(2-methoxypropyl)-2-methylfuran-3-sulfonamide (PubChem CID 102701683) has the molecular formula C13H22N2O4S and a molecular weight of 302.40 g/mol. Its IUPAC name is 5-[(cyclopropylamino)methyl]-N-(2-methoxypropyl)-2-methylfuran-3-sulfonamide.
| Compound Name | 5-[(cyclopropylamino)methyl]-N-(2-methoxypropyl)-2-methylfuran-3-sulfonamide |
|---|---|
| PubChem CID | 102701683 |
| Molecular Formula | C13H22N2O4S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 5-[(cyclopropylamino)methyl]-N-(2-methoxypropyl)-2-methylfuran-3-sulfonamide |
| SMILES | COC(C)CNS(=O)(=O)c1cc(CNC2CC2)oc1C |
| InChI | InChI=1S/C13H22N2O4S/c1-9(18-3)7-15-20(16,17)13-6-12(19-10(13)2)8-14-11-4-5-11/h6,9,11,14-15H,4-5,7-8H2,1-3H3 |
| InChIKey | CTEVIQYTIHHNKN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |