C14H17BrN2O3S — CID 106055076
5-(aminomethyl)-2-bromo-N-(1-phenylpropyl)furan-3-sulfonamide (PubChem CID 106055076) has the molecular formula C14H17BrN2O3S and a molecular weight of 373.27 g/mol. Its IUPAC name is 5-(aminomethyl)-2-bromo-N-(1-phenylpropyl)furan-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-bromo-N-(1-phenylpropyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 106055076 |
| Molecular Formula | C14H17BrN2O3S |
| Molecular Weight | 373.27 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 5-(aminomethyl)-2-bromo-N-(1-phenylpropyl)furan-3-sulfonamide |
| SMILES | CCC(NS(=O)(=O)c1cc(CN)oc1Br)c1ccccc1 |
| InChI | InChI=1S/C14H17BrN2O3S/c1-2-12(10-6-4-3-5-7-10)17-21(18,19)13-8-11(9-16)20-14(13)15/h3-8,12,17H,2,9,16H2,1H3 |
| InChIKey | JQWGMDRKYWEKGO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |