C12H21BrN2O4S — CID 106067533
2-bromo-5-(ethylaminomethyl)-N-(4-methoxybutan-2-yl)furan-3-sulfonamide (PubChem CID 106067533) has the molecular formula C12H21BrN2O4S and a molecular weight of 369.28 g/mol. Its IUPAC name is 2-bromo-5-(ethylaminomethyl)-N-(4-methoxybutan-2-yl)furan-3-sulfonamide.
| Compound Name | 2-bromo-5-(ethylaminomethyl)-N-(4-methoxybutan-2-yl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 106067533 |
| Molecular Formula | C12H21BrN2O4S |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 2-bromo-5-(ethylaminomethyl)-N-(4-methoxybutan-2-yl)furan-3-sulfonamide |
| SMILES | CCNCc1cc(S(=O)(=O)NC(C)CCOC)c(Br)o1 |
| InChI | InChI=1S/C12H21BrN2O4S/c1-4-14-8-10-7-11(12(13)19-10)20(16,17)15-9(2)5-6-18-3/h7,9,14-15H,4-6,8H2,1-3H3 |
| InChIKey | ROTZKRPZXWBHNN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |