C10H12ClF2NO2S — CID 105118065
5-(chloromethyl)-2,3-difluoro-N-propan-2-ylbenzenesulfonamide (PubChem CID 105118065) has the molecular formula C10H12ClF2NO2S and a molecular weight of 283.73 g/mol. Its IUPAC name is 5-(chloromethyl)-2,3-difluoro-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 5-(chloromethyl)-2,3-difluoro-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 105118065 |
| Molecular Formula | C10H12ClF2NO2S |
| Molecular Weight | 283.73 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 5-(chloromethyl)-2,3-difluoro-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)NS(=O)(=O)c1cc(CCl)cc(F)c1F |
| InChI | InChI=1S/C10H12ClF2NO2S/c1-6(2)14-17(15,16)9-4-7(5-11)3-8(12)10(9)13/h3-4,6,14H,5H2,1-2H3 |
| InChIKey | UWYCSLGSKKOOHE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.73 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|