C13H16BrFN2O2S — CID 114413990
1-[5-bromo-3-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-2-fluorophenyl]-N-methylmethanamine (PubChem CID 114413990) has the molecular formula C13H16BrFN2O2S and a molecular weight of 363.25 g/mol. Its IUPAC name is 1-[5-bromo-3-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-2-fluorophenyl]-N-methylmethanamine.
| Compound Name | 1-[5-bromo-3-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-2-fluorophenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 114413990 |
| Molecular Formula | C13H16BrFN2O2S |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 1-[5-bromo-3-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-2-fluorophenyl]-N-methylmethanamine |
| SMILES | CNCc1cc(Br)cc(S(=O)(=O)N2CC=CCC2)c1F |
| InChI | InChI=1S/C13H16BrFN2O2S/c1-16-9-10-7-11(14)8-12(13(10)15)20(18,19)17-5-3-2-4-6-17/h2-3,7-8,16H,4-6,9H2,1H3 |
| InChIKey | IIUTVHBMJCXZQY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|