C12H17BrN2O3S — CID 114414123
N-[[5-bromo-4-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)furan-2-yl]methyl]ethanamine (PubChem CID 114414123) has the molecular formula C12H17BrN2O3S and a molecular weight of 349.25 g/mol. Its IUPAC name is N-[[5-bromo-4-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)furan-2-yl]methyl]ethanamine.
| Compound Name | N-[[5-bromo-4-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)furan-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 114414123 |
| Molecular Formula | C12H17BrN2O3S |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | N-[[5-bromo-4-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)furan-2-yl]methyl]ethanamine |
| SMILES | CCNCc1cc(S(=O)(=O)N2CC=CCC2)c(Br)o1 |
| InChI | InChI=1S/C12H17BrN2O3S/c1-2-14-9-10-8-11(12(13)18-10)19(16,17)15-6-4-3-5-7-15/h3-4,8,14H,2,5-7,9H2,1H3 |
| InChIKey | WEEASIFUXDUKOU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|