C15H22N2O3S — CID 114414047
N-[[3-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-4-methoxyphenyl]methyl]ethanamine (PubChem CID 114414047) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is N-[[3-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-4-methoxyphenyl]methyl]ethanamine.
| Compound Name | N-[[3-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-4-methoxyphenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 114414047 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | N-[[3-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-4-methoxyphenyl]methyl]ethanamine |
| SMILES | CCNCc1ccc(OC)c(S(=O)(=O)N2CC=CCC2)c1 |
| InChI | InChI=1S/C15H22N2O3S/c1-3-16-12-13-7-8-14(20-2)15(11-13)21(18,19)17-9-5-4-6-10-17/h4-5,7-8,11,16H,3,6,9-10,12H2,1-2H3 |
| InChIKey | DPEQRFUAQDZDDP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|