C15H20N2O5S — CID 166302572
3-[3-(3,6-dihydro-2H-pyridin-1-ylsulfonylamino)-4-methoxyphenyl]propanoic acid (PubChem CID 166302572) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is 3-[3-(3,6-dihydro-2H-pyridin-1-ylsulfonylamino)-4-methoxyphenyl]propanoic acid.
| Compound Name | 3-[3-(3,6-dihydro-2H-pyridin-1-ylsulfonylamino)-4-methoxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 166302572 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 3-[3-(3,6-dihydro-2H-pyridin-1-ylsulfonylamino)-4-methoxyphenyl]propanoic acid |
| SMILES | COc1ccc(CCC(=O)O)cc1NS(=O)(=O)N1CC=CCC1 |
| InChI | InChI=1S/C15H20N2O5S/c1-22-14-7-5-12(6-8-15(18)19)11-13(14)16-23(20,21)17-9-3-2-4-10-17/h2-3,5,7,11,16H,4,6,8-10H2,1H3,(H,18,19) |
| InChIKey | JLSJYWNYWCPSHJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|