C11H15NO4S — CID 114413744
[4-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-5-methylfuran-2-yl]methanol (PubChem CID 114413744) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is [4-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-5-methylfuran-2-yl]methanol.
| Compound Name | [4-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-5-methylfuran-2-yl]methanol |
|---|---|
| PubChem CID | 114413744 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | [4-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-5-methylfuran-2-yl]methanol |
| SMILES | Cc1oc(CO)cc1S(=O)(=O)N1CC=CCC1 |
| InChI | InChI=1S/C11H15NO4S/c1-9-11(7-10(8-13)16-9)17(14,15)12-5-3-2-4-6-12/h2-3,7,13H,4-6,8H2,1H3 |
| InChIKey | XYJGHQPTOLOLNR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|