C14H19NO4S — CID 114413752
2-[2-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-5-methoxyphenyl]ethanol (PubChem CID 114413752) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-[2-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-5-methoxyphenyl]ethanol.
| Compound Name | 2-[2-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-5-methoxyphenyl]ethanol |
|---|---|
| PubChem CID | 114413752 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-[2-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-5-methoxyphenyl]ethanol |
| SMILES | COc1ccc(S(=O)(=O)N2CC=CCC2)c(CCO)c1 |
| InChI | InChI=1S/C14H19NO4S/c1-19-13-5-6-14(12(11-13)7-10-16)20(17,18)15-8-3-2-4-9-15/h2-3,5-6,11,16H,4,7-10H2,1H3 |
| InChIKey | CDAYFAMLWHFGTH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|