C11H15BrN2O2S2 — CID 114413955
1-[5-bromo-4-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)thiophen-2-yl]-N-methylmethanamine (PubChem CID 114413955) has the molecular formula C11H15BrN2O2S2 and a molecular weight of 351.29 g/mol. Its IUPAC name is 1-[5-bromo-4-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)thiophen-2-yl]-N-methylmethanamine.
| Compound Name | 1-[5-bromo-4-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)thiophen-2-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 114413955 |
| Molecular Formula | C11H15BrN2O2S2 |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 1-[5-bromo-4-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)thiophen-2-yl]-N-methylmethanamine |
| SMILES | CNCc1cc(S(=O)(=O)N2CC=CCC2)c(Br)s1 |
| InChI | InChI=1S/C11H15BrN2O2S2/c1-13-8-9-7-10(11(12)17-9)18(15,16)14-5-3-2-4-6-14/h2-3,7,13H,4-6,8H2,1H3 |
| InChIKey | IYQMQWNRLMHGJA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|