C14H21BrN2O2S2 — CID 114414223
N-[[5-bromo-4-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]thiophen-2-yl]methyl]propan-1-amine (PubChem CID 114414223) has the molecular formula C14H21BrN2O2S2 and a molecular weight of 393.37 g/mol. Its IUPAC name is N-[[5-bromo-4-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]thiophen-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-bromo-4-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]thiophen-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 114414223 |
| Molecular Formula | C14H21BrN2O2S2 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | N-[[5-bromo-4-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]thiophen-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(S(=O)(=O)N2CC=C(C)CC2)c(Br)s1 |
| InChI | InChI=1S/C14H21BrN2O2S2/c1-3-6-16-10-12-9-13(14(15)20-12)21(18,19)17-7-4-11(2)5-8-17/h4,9,16H,3,5-8,10H2,1-2H3 |
| InChIKey | WCPDFHXZQNIORW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|