C13H21BrN2O2S3 — CID 106093210
2-bromo-N-[(1-methylsulfanylcyclopropyl)methyl]-5-(propylaminomethyl)thiophene-3-sulfonamide (PubChem CID 106093210) has the molecular formula C13H21BrN2O2S3 and a molecular weight of 413.43 g/mol. Its IUPAC name is 2-bromo-N-[(1-methylsulfanylcyclopropyl)methyl]-5-(propylaminomethyl)thiophene-3-sulfonamide.
| Compound Name | 2-bromo-N-[(1-methylsulfanylcyclopropyl)methyl]-5-(propylaminomethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106093210 |
| Molecular Formula | C13H21BrN2O2S3 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 411.99 |
| IUPAC Name | 2-bromo-N-[(1-methylsulfanylcyclopropyl)methyl]-5-(propylaminomethyl)thiophene-3-sulfonamide |
| SMILES | CCCNCc1cc(S(=O)(=O)NCC2(SC)CC2)c(Br)s1 |
| InChI | InChI=1S/C13H21BrN2O2S3/c1-3-6-15-8-10-7-11(12(14)20-10)21(17,18)16-9-13(19-2)4-5-13/h7,15-16H,3-6,8-9H2,1-2H3 |
| InChIKey | NXPWUMBZSYTOHM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|