C12H19BrN2O3S2 — CID 106072392
2-bromo-N-(oxolan-3-yl)-5-(propylaminomethyl)thiophene-3-sulfonamide (PubChem CID 106072392) has the molecular formula C12H19BrN2O3S2 and a molecular weight of 383.33 g/mol. Its IUPAC name is 2-bromo-N-(oxolan-3-yl)-5-(propylaminomethyl)thiophene-3-sulfonamide.
| Compound Name | 2-bromo-N-(oxolan-3-yl)-5-(propylaminomethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106072392 |
| Molecular Formula | C12H19BrN2O3S2 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 2-bromo-N-(oxolan-3-yl)-5-(propylaminomethyl)thiophene-3-sulfonamide |
| SMILES | CCCNCc1cc(S(=O)(=O)NC2CCOC2)c(Br)s1 |
| InChI | InChI=1S/C12H19BrN2O3S2/c1-2-4-14-7-10-6-11(12(13)19-10)20(16,17)15-9-3-5-18-8-9/h6,9,14-15H,2-5,7-8H2,1H3 |
| InChIKey | LQMWXWWGVRMKRC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|