C13H19BrN2O2S3 — CID 106081522
2-bromo-5-[(cyclopropylamino)methyl]-N-(thian-3-yl)thiophene-3-sulfonamide (PubChem CID 106081522) has the molecular formula C13H19BrN2O2S3 and a molecular weight of 411.41 g/mol. Its IUPAC name is 2-bromo-5-[(cyclopropylamino)methyl]-N-(thian-3-yl)thiophene-3-sulfonamide.
| Compound Name | 2-bromo-5-[(cyclopropylamino)methyl]-N-(thian-3-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106081522 |
| Molecular Formula | C13H19BrN2O2S3 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 409.98 |
| IUPAC Name | 2-bromo-5-[(cyclopropylamino)methyl]-N-(thian-3-yl)thiophene-3-sulfonamide |
| SMILES | O=S(=O)(NC1CCCSC1)c1cc(CNC2CC2)sc1Br |
| InChI | InChI=1S/C13H19BrN2O2S3/c14-13-12(6-11(20-13)7-15-9-3-4-9)21(17,18)16-10-2-1-5-19-8-10/h6,9-10,15-16H,1-5,7-8H2 |
| InChIKey | WGWAAXOMHQMMRY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |