C10H14BrNO4S2 — CID 114135006
2-bromo-5-(hydroxymethyl)-N-(oxan-3-yl)thiophene-3-sulfonamide (PubChem CID 114135006) has the molecular formula C10H14BrNO4S2 and a molecular weight of 356.26 g/mol. Its IUPAC name is 2-bromo-5-(hydroxymethyl)-N-(oxan-3-yl)thiophene-3-sulfonamide.
| Compound Name | 2-bromo-5-(hydroxymethyl)-N-(oxan-3-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 114135006 |
| Molecular Formula | C10H14BrNO4S2 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 354.95 |
| IUPAC Name | 2-bromo-5-(hydroxymethyl)-N-(oxan-3-yl)thiophene-3-sulfonamide |
| SMILES | O=S(=O)(NC1CCCOC1)c1cc(CO)sc1Br |
| InChI | InChI=1S/C10H14BrNO4S2/c11-10-9(4-8(5-13)17-10)18(14,15)12-7-2-1-3-16-6-7/h4,7,12-13H,1-3,5-6H2 |
| InChIKey | LMENGTZGTREPAF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |