C10H15NO4S2 — CID 114135005
5-(hydroxymethyl)-N-(oxan-3-yl)thiophene-2-sulfonamide (PubChem CID 114135005) has the molecular formula C10H15NO4S2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 5-(hydroxymethyl)-N-(oxan-3-yl)thiophene-2-sulfonamide.
| Compound Name | 5-(hydroxymethyl)-N-(oxan-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 114135005 |
| Molecular Formula | C10H15NO4S2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 5-(hydroxymethyl)-N-(oxan-3-yl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NC1CCCOC1)c1ccc(CO)s1 |
| InChI | InChI=1S/C10H15NO4S2/c12-6-9-3-4-10(16-9)17(13,14)11-8-2-1-5-15-7-8/h3-4,8,11-12H,1-2,5-7H2 |
| InChIKey | WVMXROIOJPJOFM-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |