C12H19NO3S3 — CID 106000848
5-(hydroxymethyl)-2-methyl-N-[(1-methylsulfanylcyclobutyl)methyl]thiophene-3-sulfonamide (PubChem CID 106000848) has the molecular formula C12H19NO3S3 and a molecular weight of 321.49 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-methyl-N-[(1-methylsulfanylcyclobutyl)methyl]thiophene-3-sulfonamide.
| Compound Name | 5-(hydroxymethyl)-2-methyl-N-[(1-methylsulfanylcyclobutyl)methyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106000848 |
| Molecular Formula | C12H19NO3S3 |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 5-(hydroxymethyl)-2-methyl-N-[(1-methylsulfanylcyclobutyl)methyl]thiophene-3-sulfonamide |
| SMILES | CSC1(CNS(=O)(=O)c2cc(CO)sc2C)CCC1 |
| InChI | InChI=1S/C12H19NO3S3/c1-9-11(6-10(7-14)18-9)19(15,16)13-8-12(17-2)4-3-5-12/h6,13-14H,3-5,7-8H2,1-2H3 |
| InChIKey | CNCTXCZNAYODTH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |