C14H23NO3S3 — CID 106001847
5-(hydroxymethyl)-2-methyl-N-[(1-methylsulfanylcyclohexyl)methyl]thiophene-3-sulfonamide (PubChem CID 106001847) has the molecular formula C14H23NO3S3 and a molecular weight of 349.54 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-methyl-N-[(1-methylsulfanylcyclohexyl)methyl]thiophene-3-sulfonamide.
| Compound Name | 5-(hydroxymethyl)-2-methyl-N-[(1-methylsulfanylcyclohexyl)methyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106001847 |
| Molecular Formula | C14H23NO3S3 |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 5-(hydroxymethyl)-2-methyl-N-[(1-methylsulfanylcyclohexyl)methyl]thiophene-3-sulfonamide |
| SMILES | CSC1(CNS(=O)(=O)c2cc(CO)sc2C)CCCCC1 |
| InChI | InChI=1S/C14H23NO3S3/c1-11-13(8-12(9-16)20-11)21(17,18)15-10-14(19-2)6-4-3-5-7-14/h8,15-16H,3-7,9-10H2,1-2H3 |
| InChIKey | NRSQLBOWWWYOAH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |