C10H15NO3S3 — CID 106002257
5-(hydroxymethyl)-N-[(1-methylsulfanylcyclopropyl)methyl]thiophene-3-sulfonamide (PubChem CID 106002257) has the molecular formula C10H15NO3S3 and a molecular weight of 293.44 g/mol. Its IUPAC name is 5-(hydroxymethyl)-N-[(1-methylsulfanylcyclopropyl)methyl]thiophene-3-sulfonamide.
| Compound Name | 5-(hydroxymethyl)-N-[(1-methylsulfanylcyclopropyl)methyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106002257 |
| Molecular Formula | C10H15NO3S3 |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 5-(hydroxymethyl)-N-[(1-methylsulfanylcyclopropyl)methyl]thiophene-3-sulfonamide |
| SMILES | CSC1(CNS(=O)(=O)c2csc(CO)c2)CC1 |
| InChI | InChI=1S/C10H15NO3S3/c1-15-10(2-3-10)7-11-17(13,14)9-4-8(5-12)16-6-9/h4,6,11-12H,2-3,5,7H2,1H3 |
| InChIKey | GRYXVRABDIGGSL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |