C13H16BrClFNO3S — CID 102969073
1-[5-bromo-3-(chloromethyl)-2-fluorophenyl]sulfonyl-3-methoxypiperidine (PubChem CID 102969073) has the molecular formula C13H16BrClFNO3S and a molecular weight of 400.70 g/mol. Its IUPAC name is 1-[5-bromo-3-(chloromethyl)-2-fluorophenyl]sulfonyl-3-methoxypiperidine.
| Compound Name | 1-[5-bromo-3-(chloromethyl)-2-fluorophenyl]sulfonyl-3-methoxypiperidine |
|---|---|
| PubChem CID | 102969073 |
| Molecular Formula | C13H16BrClFNO3S |
| Molecular Weight | 400.70 g/mol |
| Exact Mass | 398.97 |
| IUPAC Name | 1-[5-bromo-3-(chloromethyl)-2-fluorophenyl]sulfonyl-3-methoxypiperidine |
| SMILES | COC1CCCN(S(=O)(=O)c2cc(Br)cc(CCl)c2F)C1 |
| InChI | InChI=1S/C13H16BrClFNO3S/c1-20-11-3-2-4-17(8-11)21(18,19)12-6-10(14)5-9(7-15)13(12)16/h5-6,11H,2-4,7-8H2,1H3 |
| InChIKey | WPQNTFDZCUWRNC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.70 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|