C12H14Cl3NO3S — CID 103541205
1-[2,5-dichloro-3-(chloromethyl)phenyl]sulfonyl-3-methoxypyrrolidine (PubChem CID 103541205) has the molecular formula C12H14Cl3NO3S and a molecular weight of 358.67 g/mol. Its IUPAC name is 1-[2,5-dichloro-3-(chloromethyl)phenyl]sulfonyl-3-methoxypyrrolidine.
| Compound Name | 1-[2,5-dichloro-3-(chloromethyl)phenyl]sulfonyl-3-methoxypyrrolidine |
|---|---|
| PubChem CID | 103541205 |
| Molecular Formula | C12H14Cl3NO3S |
| Molecular Weight | 358.67 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | 1-[2,5-dichloro-3-(chloromethyl)phenyl]sulfonyl-3-methoxypyrrolidine |
| SMILES | COC1CCN(S(=O)(=O)c2cc(Cl)cc(CCl)c2Cl)C1 |
| InChI | InChI=1S/C12H14Cl3NO3S/c1-19-10-2-3-16(7-10)20(17,18)11-5-9(14)4-8(6-13)12(11)15/h4-5,10H,2-3,6-7H2,1H3 |
| InChIKey | LWKCOMZMXYYFCC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.67 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|