C14H19FN2O2S — CID 106313380
6-fluoro-2,4-dimethyl-3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]aniline (PubChem CID 106313380) has the molecular formula C14H19FN2O2S and a molecular weight of 298.38 g/mol. Its IUPAC name is 6-fluoro-2,4-dimethyl-3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]aniline.
| Compound Name | 6-fluoro-2,4-dimethyl-3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]aniline |
|---|---|
| PubChem CID | 106313380 |
| Molecular Formula | C14H19FN2O2S |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 6-fluoro-2,4-dimethyl-3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]aniline |
| SMILES | CC1=CCCN(S(=O)(=O)c2c(C)cc(F)c(N)c2C)C1 |
| InChI | InChI=1S/C14H19FN2O2S/c1-9-5-4-6-17(8-9)20(18,19)14-10(2)7-12(15)13(16)11(14)3/h5,7H,4,6,8,16H2,1-3H3 |
| InChIKey | IAMAKEGSXXMJGM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|