C13H16FNO4S2 — CID 106313643
1-(2-fluoro-5-methylsulfonylphenyl)sulfonyl-5-methyl-3,6-dihydro-2H-pyridine (PubChem CID 106313643) has the molecular formula C13H16FNO4S2 and a molecular weight of 333.41 g/mol. Its IUPAC name is 1-(2-fluoro-5-methylsulfonylphenyl)sulfonyl-5-methyl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(2-fluoro-5-methylsulfonylphenyl)sulfonyl-5-methyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 106313643 |
| Molecular Formula | C13H16FNO4S2 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 1-(2-fluoro-5-methylsulfonylphenyl)sulfonyl-5-methyl-3,6-dihydro-2H-pyridine |
| SMILES | CC1=CCCN(S(=O)(=O)c2cc(S(C)(=O)=O)ccc2F)C1 |
| InChI | InChI=1S/C13H16FNO4S2/c1-10-4-3-7-15(9-10)21(18,19)13-8-11(20(2,16)17)5-6-12(13)14/h4-6,8H,3,7,9H2,1-2H3 |
| InChIKey | INNFDNJYENAKOC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|