C13H17FN2O2S — CID 106313363
2-fluoro-3-methyl-5-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]aniline (PubChem CID 106313363) has the molecular formula C13H17FN2O2S and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-fluoro-3-methyl-5-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]aniline.
| Compound Name | 2-fluoro-3-methyl-5-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]aniline |
|---|---|
| PubChem CID | 106313363 |
| Molecular Formula | C13H17FN2O2S |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-fluoro-3-methyl-5-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]aniline |
| SMILES | CC1=CCCN(S(=O)(=O)c2cc(C)c(F)c(N)c2)C1 |
| InChI | InChI=1S/C13H17FN2O2S/c1-9-4-3-5-16(8-9)19(17,18)11-6-10(2)13(14)12(15)7-11/h4,6-7H,3,5,8,15H2,1-2H3 |
| InChIKey | LKUBRAZURSZBEI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|