C14H16BrNO4S — CID 106313475
3-bromo-4-methyl-5-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]benzoic acid (PubChem CID 106313475) has the molecular formula C14H16BrNO4S and a molecular weight of 374.26 g/mol. Its IUPAC name is 3-bromo-4-methyl-5-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]benzoic acid.
| Compound Name | 3-bromo-4-methyl-5-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]benzoic acid |
|---|---|
| PubChem CID | 106313475 |
| Molecular Formula | C14H16BrNO4S |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 3-bromo-4-methyl-5-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]benzoic acid |
| SMILES | CC1=CCCN(S(=O)(=O)c2cc(C(=O)O)cc(Br)c2C)C1 |
| InChI | InChI=1S/C14H16BrNO4S/c1-9-4-3-5-16(8-9)21(19,20)13-7-11(14(17)18)6-12(15)10(13)2/h4,6-7H,3,5,8H2,1-2H3,(H,17,18) |
| InChIKey | XSWBGQBQFOLWLW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|