C14H18BrNO4S — CID 81480056
3-bromo-5-(3,4-dimethylpyrrolidin-1-yl)sulfonyl-4-methylbenzoic acid (PubChem CID 81480056) has the molecular formula C14H18BrNO4S and a molecular weight of 376.27 g/mol. Its IUPAC name is 3-bromo-5-(3,4-dimethylpyrrolidin-1-yl)sulfonyl-4-methylbenzoic acid.
| Compound Name | 3-bromo-5-(3,4-dimethylpyrrolidin-1-yl)sulfonyl-4-methylbenzoic acid |
|---|---|
| PubChem CID | 81480056 |
| Molecular Formula | C14H18BrNO4S |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 3-bromo-5-(3,4-dimethylpyrrolidin-1-yl)sulfonyl-4-methylbenzoic acid |
| SMILES | Cc1c(Br)cc(C(=O)O)cc1S(=O)(=O)N1CC(C)C(C)C1 |
| InChI | InChI=1S/C14H18BrNO4S/c1-8-6-16(7-9(8)2)21(19,20)13-5-11(14(17)18)4-12(15)10(13)3/h4-5,8-9H,6-7H2,1-3H3,(H,17,18) |
| InChIKey | NTDBBPOMTFEYKT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |