C12H16FNO4S — CID 79187528
[3-fluoro-4-(1,4-oxazepan-4-ylsulfonyl)phenyl]methanol (PubChem CID 79187528) has the molecular formula C12H16FNO4S and a molecular weight of 289.33 g/mol. Its IUPAC name is [3-fluoro-4-(1,4-oxazepan-4-ylsulfonyl)phenyl]methanol.
| Compound Name | [3-fluoro-4-(1,4-oxazepan-4-ylsulfonyl)phenyl]methanol |
|---|---|
| PubChem CID | 79187528 |
| Molecular Formula | C12H16FNO4S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | [3-fluoro-4-(1,4-oxazepan-4-ylsulfonyl)phenyl]methanol |
| SMILES | O=S(=O)(c1ccc(CO)cc1F)N1CCCOCC1 |
| InChI | InChI=1S/C12H16FNO4S/c13-11-8-10(9-15)2-3-12(11)19(16,17)14-4-1-6-18-7-5-14/h2-3,8,15H,1,4-7,9H2 |
| InChIKey | OBARARFIPBUEPH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |