C13H18FNO4S — CID 79187593
[4-(2-ethylmorpholin-4-yl)sulfonyl-3-fluorophenyl]methanol (PubChem CID 79187593) has the molecular formula C13H18FNO4S and a molecular weight of 303.35 g/mol. Its IUPAC name is [4-(2-ethylmorpholin-4-yl)sulfonyl-3-fluorophenyl]methanol.
| Compound Name | [4-(2-ethylmorpholin-4-yl)sulfonyl-3-fluorophenyl]methanol |
|---|---|
| PubChem CID | 79187593 |
| Molecular Formula | C13H18FNO4S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | [4-(2-ethylmorpholin-4-yl)sulfonyl-3-fluorophenyl]methanol |
| SMILES | CCC1CN(S(=O)(=O)c2ccc(CO)cc2F)CCO1 |
| InChI | InChI=1S/C13H18FNO4S/c1-2-11-8-15(5-6-19-11)20(17,18)13-4-3-10(9-16)7-12(13)14/h3-4,7,11,16H,2,5-6,8-9H2,1H3 |
| InChIKey | CGNVGICKCHMURC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |