C11H13Cl2NO3S — CID 881417
4-(2,4-dichloro-3-methylphenyl)sulfonylmorpholine (PubChem CID 881417) has the molecular formula C11H13Cl2NO3S and a molecular weight of 310.20 g/mol. Its IUPAC name is 4-(2,4-dichloro-3-methylphenyl)sulfonylmorpholine.
| Compound Name | 4-(2,4-dichloro-3-methylphenyl)sulfonylmorpholine |
|---|---|
| PubChem CID | 881417 |
| Molecular Formula | C11H13Cl2NO3S |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 4-(2,4-dichloro-3-methylphenyl)sulfonylmorpholine |
| SMILES | Cc1c(Cl)ccc(S(=O)(=O)N2CCOCC2)c1Cl |
| InChI | InChI=1S/C11H13Cl2NO3S/c1-8-9(12)2-3-10(11(8)13)18(15,16)14-4-6-17-7-5-14/h2-3H,4-7H2,1H3 |
| InChIKey | MLQZCCPZZMJOFB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |