C15H19Cl2NO4S — CID 154811646
[(3aS,7aR)-2-(2,4-dichloro-3-methylphenyl)sulfonyl-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol (PubChem CID 154811646) has the molecular formula C15H19Cl2NO4S and a molecular weight of 380.29 g/mol. Its IUPAC name is [(3aS,7aR)-2-(2,4-dichloro-3-methylphenyl)sulfonyl-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol.
| Compound Name | [(3aS,7aR)-2-(2,4-dichloro-3-methylphenyl)sulfonyl-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 154811646 |
| Molecular Formula | C15H19Cl2NO4S |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | [(3aS,7aR)-2-(2,4-dichloro-3-methylphenyl)sulfonyl-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol |
| SMILES | Cc1c(Cl)ccc(S(=O)(=O)N2C[C@@H]3CCOC[C@]3(CO)C2)c1Cl |
| InChI | InChI=1S/C15H19Cl2NO4S/c1-10-12(16)2-3-13(14(10)17)23(20,21)18-6-11-4-5-22-9-15(11,7-18)8-19/h2-3,11,19H,4-9H2,1H3/t11-,15+/m0/s1 |
| InChIKey | IPPFUGICKDJMQO-XHDPSFHLSA-N |
| XLogP | 2.32 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |