C16H19Cl2NO4 — CID 154812000
1-[(3aS,7aR)-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-2-yl]-2-(2,4-dichlorophenoxy)ethanone (PubChem CID 154812000) has the molecular formula C16H19Cl2NO4 and a molecular weight of 360.24 g/mol. Its IUPAC name is 1-[(3aS,7aR)-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-2-yl]-2-(2,4-dichlorophenoxy)ethanone.
| Compound Name | 1-[(3aS,7aR)-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-2-yl]-2-(2,4-dichlorophenoxy)ethanone |
|---|---|
| PubChem CID | 154812000 |
| Molecular Formula | C16H19Cl2NO4 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 1-[(3aS,7aR)-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-2-yl]-2-(2,4-dichlorophenoxy)ethanone |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N1C[C@@H]2CCOC[C@]2(CO)C1 |
| InChI | InChI=1S/C16H19Cl2NO4/c17-12-1-2-14(13(18)5-12)23-7-15(21)19-6-11-3-4-22-10-16(11,8-19)9-20/h1-2,5,11,20H,3-4,6-10H2/t11-,16+/m0/s1 |
| InChIKey | OGKBUCZGWJXCNL-MEDUHNTESA-N |
| XLogP | 2.23 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |