C17H24Cl2N2O2 — CID 113075010
2-(2,4-dichlorophenoxy)-1-[4-(3-methylbutyl)piperazin-1-yl]ethanone (PubChem CID 113075010) has the molecular formula C17H24Cl2N2O2 and a molecular weight of 359.30 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-1-[4-(3-methylbutyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(2,4-dichlorophenoxy)-1-[4-(3-methylbutyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 113075010 |
| Molecular Formula | C17H24Cl2N2O2 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-1-[4-(3-methylbutyl)piperazin-1-yl]ethanone |
| SMILES | CC(C)CCN1CCN(C(=O)COc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C17H24Cl2N2O2/c1-13(2)5-6-20-7-9-21(10-8-20)17(22)12-23-16-4-3-14(18)11-15(16)19/h3-4,11,13H,5-10,12H2,1-2H3 |
| InChIKey | CHTZHUVLHWJJNH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |