C16H20Cl2N2O2 — CID 95750016
2-(2,4-dichlorophenoxy)-1-(4-prop-2-enyl-1,4-diazepan-1-yl)ethanone (PubChem CID 95750016) has the molecular formula C16H20Cl2N2O2 and a molecular weight of 343.25 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-1-(4-prop-2-enyl-1,4-diazepan-1-yl)ethanone.
| Compound Name | 2-(2,4-dichlorophenoxy)-1-(4-prop-2-enyl-1,4-diazepan-1-yl)ethanone |
|---|---|
| PubChem CID | 95750016 |
| Molecular Formula | C16H20Cl2N2O2 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-1-(4-prop-2-enyl-1,4-diazepan-1-yl)ethanone |
| SMILES | C=CCN1CCCN(C(=O)COc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C16H20Cl2N2O2/c1-2-6-19-7-3-8-20(10-9-19)16(21)12-22-15-5-4-13(17)11-14(15)18/h2,4-5,11H,1,3,6-10,12H2 |
| InChIKey | VCIAOYQGWSNADO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|