C15H20ClNO4S — CID 154812049
[(3aS,7aR)-2-(3-chloro-2-methylphenyl)sulfonyl-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol (PubChem CID 154812049) has the molecular formula C15H20ClNO4S and a molecular weight of 345.85 g/mol. Its IUPAC name is [(3aS,7aR)-2-(3-chloro-2-methylphenyl)sulfonyl-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol.
| Compound Name | [(3aS,7aR)-2-(3-chloro-2-methylphenyl)sulfonyl-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 154812049 |
| Molecular Formula | C15H20ClNO4S |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | [(3aS,7aR)-2-(3-chloro-2-methylphenyl)sulfonyl-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)N1C[C@@H]2CCOC[C@]2(CO)C1 |
| InChI | InChI=1S/C15H20ClNO4S/c1-11-13(16)3-2-4-14(11)22(19,20)17-7-12-5-6-21-10-15(12,8-17)9-18/h2-4,12,18H,5-10H2,1H3/t12-,15+/m0/s1 |
| InChIKey | NCZDFRHUSWYQSK-SWLSCSKDSA-N |
| XLogP | 1.67 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |