C15H21ClN2O5S — CID 122072081
2-[[4-(3-chloro-2-methylphenyl)sulfonylmorpholin-2-yl]methyl-methylamino]acetic acid (PubChem CID 122072081) has the molecular formula C15H21ClN2O5S and a molecular weight of 376.86 g/mol. Its IUPAC name is 2-[[4-(3-chloro-2-methylphenyl)sulfonylmorpholin-2-yl]methyl-methylamino]acetic acid.
| Compound Name | 2-[[4-(3-chloro-2-methylphenyl)sulfonylmorpholin-2-yl]methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 122072081 |
| Molecular Formula | C15H21ClN2O5S |
| Molecular Weight | 376.86 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2-[[4-(3-chloro-2-methylphenyl)sulfonylmorpholin-2-yl]methyl-methylamino]acetic acid |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)N1CCOC(CN(C)CC(=O)O)C1 |
| InChI | InChI=1S/C15H21ClN2O5S/c1-11-13(16)4-3-5-14(11)24(21,22)18-6-7-23-12(9-18)8-17(2)10-15(19)20/h3-5,12H,6-10H2,1-2H3,(H,19,20) |
| InChIKey | CIPYSJMBEYTTLI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.86 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |