C18H28N2O5S — CID 122072069
2-[[4-(4-tert-butylphenyl)sulfonylmorpholin-2-yl]methyl-methylamino]acetic acid (PubChem CID 122072069) has the molecular formula C18H28N2O5S and a molecular weight of 384.50 g/mol. Its IUPAC name is 2-[[4-(4-tert-butylphenyl)sulfonylmorpholin-2-yl]methyl-methylamino]acetic acid.
| Compound Name | 2-[[4-(4-tert-butylphenyl)sulfonylmorpholin-2-yl]methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 122072069 |
| Molecular Formula | C18H28N2O5S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 2-[[4-(4-tert-butylphenyl)sulfonylmorpholin-2-yl]methyl-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)CC1CN(S(=O)(=O)c2ccc(C(C)(C)C)cc2)CCO1 |
| InChI | InChI=1S/C18H28N2O5S/c1-18(2,3)14-5-7-16(8-6-14)26(23,24)20-9-10-25-15(12-20)11-19(4)13-17(21)22/h5-8,15H,9-13H2,1-4H3,(H,21,22) |
| InChIKey | HHJRBGHEJLJJHD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |