C20H30N2O4 — CID 120606955
2-[[4-[2-(4-ethylphenyl)-2-methylpropanoyl]morpholin-2-yl]methyl-methylamino]acetic acid (PubChem CID 120606955) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-[[4-[2-(4-ethylphenyl)-2-methylpropanoyl]morpholin-2-yl]methyl-methylamino]acetic acid.
| Compound Name | 2-[[4-[2-(4-ethylphenyl)-2-methylpropanoyl]morpholin-2-yl]methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 120606955 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 2-[[4-[2-(4-ethylphenyl)-2-methylpropanoyl]morpholin-2-yl]methyl-methylamino]acetic acid |
| SMILES | CCc1ccc(C(C)(C)C(=O)N2CCOC(CN(C)CC(=O)O)C2)cc1 |
| InChI | InChI=1S/C20H30N2O4/c1-5-15-6-8-16(9-7-15)20(2,3)19(25)22-10-11-26-17(13-22)12-21(4)14-18(23)24/h6-9,17H,5,10-14H2,1-4H3,(H,23,24) |
| InChIKey | MGFBUYFTINMLPA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |