C18H27N3O4 — CID 122089090
2-[[4-[(3-ethyl-4-methylphenyl)carbamoyl]morpholin-2-yl]methyl-methylamino]acetic acid (PubChem CID 122089090) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-[[4-[(3-ethyl-4-methylphenyl)carbamoyl]morpholin-2-yl]methyl-methylamino]acetic acid.
| Compound Name | 2-[[4-[(3-ethyl-4-methylphenyl)carbamoyl]morpholin-2-yl]methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 122089090 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 2-[[4-[(3-ethyl-4-methylphenyl)carbamoyl]morpholin-2-yl]methyl-methylamino]acetic acid |
| SMILES | CCc1cc(NC(=O)N2CCOC(CN(C)CC(=O)O)C2)ccc1C |
| InChI | InChI=1S/C18H27N3O4/c1-4-14-9-15(6-5-13(14)2)19-18(24)21-7-8-25-16(11-21)10-20(3)12-17(22)23/h5-6,9,16H,4,7-8,10-12H2,1-3H3,(H,19,24)(H,22,23) |
| InChIKey | NKGNJKMHUZMQEQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |