C15H18ClNO6S — CID 154811374
5-[[(3aS,7aR)-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-2-yl]sulfonyl]-2-chlorobenzoic acid (PubChem CID 154811374) has the molecular formula C15H18ClNO6S and a molecular weight of 375.83 g/mol. Its IUPAC name is 5-[[(3aS,7aR)-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-2-yl]sulfonyl]-2-chlorobenzoic acid.
| Compound Name | 5-[[(3aS,7aR)-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-2-yl]sulfonyl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 154811374 |
| Molecular Formula | C15H18ClNO6S |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 5-[[(3aS,7aR)-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-2-yl]sulfonyl]-2-chlorobenzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)N2C[C@@H]3CCOC[C@]3(CO)C2)ccc1Cl |
| InChI | InChI=1S/C15H18ClNO6S/c16-13-2-1-11(5-12(13)14(19)20)24(21,22)17-6-10-3-4-23-9-15(10,7-17)8-18/h1-2,5,10,18H,3-4,6-9H2,(H,19,20)/t10-,15+/m0/s1 |
| InChIKey | SNNQTPHMSHSSDW-ZUZCIYMTSA-N |
| XLogP | 1.06 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |