C17H24N2O3 — CID 154811787
(3aS,7aR)-N-(2-ethylphenyl)-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-2-carboxamide (PubChem CID 154811787) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is (3aS,7aR)-N-(2-ethylphenyl)-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-2-carboxamide.
| Compound Name | (3aS,7aR)-N-(2-ethylphenyl)-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 154811787 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | (3aS,7aR)-N-(2-ethylphenyl)-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-2-carboxamide |
| SMILES | CCc1ccccc1NC(=O)N1C[C@@H]2CCOC[C@]2(CO)C1 |
| InChI | InChI=1S/C17H24N2O3/c1-2-13-5-3-4-6-15(13)18-16(21)19-9-14-7-8-22-12-17(14,10-19)11-20/h3-6,14,20H,2,7-12H2,1H3,(H,18,21)/t14-,17+/m0/s1 |
| InChIKey | BHVKVSYXZGDZKJ-WMLDXEAASA-N |
| XLogP | 2.11 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |