C17H22N2O4 — CID 154811980
(3aR,7aR)-2-[(2-ethylphenyl)carbamoyl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 154811980) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is (3aR,7aR)-2-[(2-ethylphenyl)carbamoyl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,7aR)-2-[(2-ethylphenyl)carbamoyl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 154811980 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (3aR,7aR)-2-[(2-ethylphenyl)carbamoyl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | CCc1ccccc1NC(=O)N1C[C@@H]2CCOC[C@]2(C(=O)O)C1 |
| InChI | InChI=1S/C17H22N2O4/c1-2-12-5-3-4-6-14(12)18-16(22)19-9-13-7-8-23-11-17(13,10-19)15(20)21/h3-6,13H,2,7-11H2,1H3,(H,18,22)(H,20,21)/t13-,17+/m0/s1 |
| InChIKey | JYVBWDVFLSPMNL-SUMWQHHRSA-N |
| XLogP | 2.20 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |