C17H22N2O5 — CID 146107150
(3aR,6aR)-5-[(4-ethyl-3-methoxyphenyl)carbamoyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 146107150) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is (3aR,6aR)-5-[(4-ethyl-3-methoxyphenyl)carbamoyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-5-[(4-ethyl-3-methoxyphenyl)carbamoyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 146107150 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (3aR,6aR)-5-[(4-ethyl-3-methoxyphenyl)carbamoyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | CCc1ccc(NC(=O)N2C[C@@H]3COC[C@]3(C(=O)O)C2)cc1OC |
| InChI | InChI=1S/C17H22N2O5/c1-3-11-4-5-13(6-14(11)23-2)18-16(22)19-7-12-8-24-10-17(12,9-19)15(20)21/h4-6,12H,3,7-10H2,1-2H3,(H,18,22)(H,20,21)/t12-,17-/m1/s1 |
| InChIKey | AEOFIIJKKIHWII-SJKOYZFVSA-N |
| XLogP | 1.82 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |