C13H17ClN4O4 — CID 138006188
(3aR,6aR)-5-[(4-chloro-1-ethylpyrazol-3-yl)carbamoyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 138006188) has the molecular formula C13H17ClN4O4 and a molecular weight of 328.76 g/mol. Its IUPAC name is (3aR,6aR)-5-[(4-chloro-1-ethylpyrazol-3-yl)carbamoyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-5-[(4-chloro-1-ethylpyrazol-3-yl)carbamoyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 138006188 |
| Molecular Formula | C13H17ClN4O4 |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (3aR,6aR)-5-[(4-chloro-1-ethylpyrazol-3-yl)carbamoyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | CCn1cc(Cl)c(NC(=O)N2C[C@@H]3COC[C@]3(C(=O)O)C2)n1 |
| InChI | InChI=1S/C13H17ClN4O4/c1-2-18-4-9(14)10(16-18)15-12(21)17-3-8-5-22-7-13(8,6-17)11(19)20/h4,8H,2-3,5-7H2,1H3,(H,19,20)(H,15,16,21)/t8-,13-/m1/s1 |
| InChIKey | GASPXJVIHJIZIJ-AMIZOPFISA-N |
| XLogP | 1.12 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |