C14H16FN3O4 — CID 136583595
(3aR,6aR)-5-[(3-fluoro-2-pyridinyl)methylcarbamoyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 136583595) has the molecular formula C14H16FN3O4 and a molecular weight of 309.30 g/mol. Its IUPAC name is (3aR,6aR)-5-[(3-fluoro-2-pyridinyl)methylcarbamoyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-5-[(3-fluoro-2-pyridinyl)methylcarbamoyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 136583595 |
| Molecular Formula | C14H16FN3O4 |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (3aR,6aR)-5-[(3-fluoro-2-pyridinyl)methylcarbamoyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(NCc1ncccc1F)N1C[C@@H]2COC[C@]2(C(=O)O)C1 |
| InChI | InChI=1S/C14H16FN3O4/c15-10-2-1-3-16-11(10)4-17-13(21)18-5-9-6-22-8-14(9,7-18)12(19)20/h1-3,9H,4-8H2,(H,17,21)(H,19,20)/t9-,14-/m1/s1 |
| InChIKey | JFIBYGQRBGHZMY-YMTOWFKASA-N |
| XLogP | 0.46 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |