C14H20FN3O2 — CID 97240765
(3S)-3-(ethoxymethyl)-N-[(3-fluoro-2-pyridinyl)methyl]pyrrolidine-1-carboxamide (PubChem CID 97240765) has the molecular formula C14H20FN3O2 and a molecular weight of 281.33 g/mol. Its IUPAC name is (3S)-3-(ethoxymethyl)-N-[(3-fluoro-2-pyridinyl)methyl]pyrrolidine-1-carboxamide.
| Compound Name | (3S)-3-(ethoxymethyl)-N-[(3-fluoro-2-pyridinyl)methyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 97240765 |
| Molecular Formula | C14H20FN3O2 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | (3S)-3-(ethoxymethyl)-N-[(3-fluoro-2-pyridinyl)methyl]pyrrolidine-1-carboxamide |
| SMILES | CCOC[C@H]1CCN(C(=O)NCc2ncccc2F)C1 |
| InChI | InChI=1S/C14H20FN3O2/c1-2-20-10-11-5-7-18(9-11)14(19)17-8-13-12(15)4-3-6-16-13/h3-4,6,11H,2,5,7-10H2,1H3,(H,17,19)/t11-/m0/s1 |
| InChIKey | BQXKCRHTXQBHJB-NSHDSACASA-N |
| XLogP | 1.79 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |